C21H24FN3OS — CID 78891200
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-ethyl-N-[1-(4-fluorophenyl)ethyl]acetamide (PubChem CID 78891200) has the molecular formula C21H24FN3OS and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-ethyl-N-[1-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-ethyl-N-[1-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 78891200 |
| Molecular Formula | C21H24FN3OS |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-ethyl-N-[1-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CCN(C(=O)CSC(C)c1nc2ccccc2[nH]1)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3OS/c1-4-25(14(2)16-9-11-17(22)12-10-16)20(26)13-27-15(3)21-23-18-7-5-6-8-19(18)24-21/h5-12,14-15H,4,13H2,1-3H3,(H,23,24) |
| InChIKey | ICXIHQWSEUJQRL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |