C19H20BrN3OS — CID 78768440
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(4-bromophenyl)methyl]-N-methylacetamide (PubChem CID 78768440) has the molecular formula C19H20BrN3OS and a molecular weight of 418.36 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(4-bromophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(4-bromophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 78768440 |
| Molecular Formula | C19H20BrN3OS |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(4-bromophenyl)methyl]-N-methylacetamide |
| SMILES | CC(SCC(=O)N(C)Cc1ccc(Br)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H20BrN3OS/c1-13(19-21-16-5-3-4-6-17(16)22-19)25-12-18(24)23(2)11-14-7-9-15(20)10-8-14/h3-10,13H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | KSMZXNCQUHYPLS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |