C19H24F3N5O — CID 78894810
2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine (PubChem CID 78894810) has the molecular formula C19H24F3N5O and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 78894810 |
| Molecular Formula | C19H24F3N5O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine |
| SMILES | FC(F)(F)COc1cccc(CNCCN2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C19H24F3N5O/c20-19(21,22)15-28-17-4-1-3-16(13-17)14-23-7-8-26-9-11-27(12-10-26)18-24-5-2-6-25-18/h1-6,13,23H,7-12,14-15H2 |
| InChIKey | JMBTYNVWABLJJA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|