C22H20ClF3N2O2 — CID 78895049
N-[(6-chloro-3-pyridinyl)methyl]-1-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methanamine (PubChem CID 78895049) has the molecular formula C22H20ClF3N2O2 and a molecular weight of 436.86 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-1-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methanamine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-1-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 78895049 |
| Molecular Formula | C22H20ClF3N2O2 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-1-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methanamine |
| SMILES | COc1cc(CNCc2ccc(Cl)nc2)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20ClF3N2O2/c1-29-20-10-15(11-27-12-17-6-8-21(23)28-13-17)5-7-19(20)30-14-16-3-2-4-18(9-16)22(24,25)26/h2-10,13,27H,11-12,14H2,1H3 |
| InChIKey | QBHVEZZBOAPLEI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|