C17H23ClN4O3S — CID 78901193
N-(5-chloro-2-cyanophenyl)-2-[2-[2-(methanesulfonamido)ethyl]piperidin-1-yl]acetamide (PubChem CID 78901193) has the molecular formula C17H23ClN4O3S and a molecular weight of 398.92 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2-[2-[2-(methanesulfonamido)ethyl]piperidin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2-[2-[2-(methanesulfonamido)ethyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 78901193 |
| Molecular Formula | C17H23ClN4O3S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2-[2-[2-(methanesulfonamido)ethyl]piperidin-1-yl]acetamide |
| SMILES | CS(=O)(=O)NCCC1CCCCN1CC(=O)Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C17H23ClN4O3S/c1-26(24,25)20-8-7-15-4-2-3-9-22(15)12-17(23)21-16-10-14(18)6-5-13(16)11-19/h5-6,10,15,20H,2-4,7-9,12H2,1H3,(H,21,23) |
| InChIKey | DZLMCTUVJFVHOY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |