C24H23N5OS — CID 78903823
N-phenyl-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzamide (PubChem CID 78903823) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is N-phenyl-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-phenyl-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78903823 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-phenyl-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(CN2CCN(c3ncnc4sccc34)CC2)c1 |
| InChI | InChI=1S/C24H23N5OS/c30-23(27-20-7-2-1-3-8-20)19-6-4-5-18(15-19)16-28-10-12-29(13-11-28)22-21-9-14-31-24(21)26-17-25-22/h1-9,14-15,17H,10-13,16H2,(H,27,30) |
| InChIKey | YHTMKSHSMMHFOP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |