C18H13FN4OS2 — CID 78904810
6-fluoro-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78904810) has the molecular formula C18H13FN4OS2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 6-fluoro-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78904810 |
| Molecular Formula | C18H13FN4OS2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 6-fluoro-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cc(F)cc4[nH]c(=S)[nH]c34)n2)cc1 |
| InChI | InChI=1S/C18H13FN4OS2/c1-9-2-4-10(5-3-9)14-8-26-18(21-14)23-16(24)12-6-11(19)7-13-15(12)22-17(25)20-13/h2-8H,1H3,(H2,20,22,25)(H,21,23,24) |
| InChIKey | KPTAWESSEXTNQN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|