C19H15FN4O3S2 — CID 78904812
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78904812) has the molecular formula C19H15FN4O3S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78904812 |
| Molecular Formula | C19H15FN4O3S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3cc(F)cc4[nH]c(=S)[nH]c34)n2)c1 |
| InChI | InChI=1S/C19H15FN4O3S2/c1-26-10-3-4-15(27-2)11(7-10)14-8-29-19(22-14)24-17(25)12-5-9(20)6-13-16(12)23-18(28)21-13/h3-8H,1-2H3,(H2,21,23,28)(H,22,24,25) |
| InChIKey | OVDNFHLTDXYURV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|