C14H11ClIN3 — CID 78912750
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-4-iodoaniline (PubChem CID 78912750) has the molecular formula C14H11ClIN3 and a molecular weight of 383.62 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-4-iodoaniline.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-4-iodoaniline |
|---|---|
| PubChem CID | 78912750 |
| Molecular Formula | C14H11ClIN3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-4-iodoaniline |
| SMILES | Clc1ccc2nc(CNc3ccc(I)cc3)cn2c1 |
| InChI | InChI=1S/C14H11ClIN3/c15-10-1-6-14-18-13(9-19(14)8-10)7-17-12-4-2-11(16)3-5-12/h1-6,8-9,17H,7H2 |
| InChIKey | IHAIPVOQWBAWEZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|