C12H11Cl2NO4S — CID 78970275
2,4-dichloro-5-[ethyl(prop-2-ynyl)sulfamoyl]benzoic acid (PubChem CID 78970275) has the molecular formula C12H11Cl2NO4S and a molecular weight of 336.20 g/mol. Its IUPAC name is 2,4-dichloro-5-[ethyl(prop-2-ynyl)sulfamoyl]benzoic acid.
| Compound Name | 2,4-dichloro-5-[ethyl(prop-2-ynyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 78970275 |
| Molecular Formula | C12H11Cl2NO4S |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2,4-dichloro-5-[ethyl(prop-2-ynyl)sulfamoyl]benzoic acid |
| SMILES | C#CCN(CC)S(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2NO4S/c1-3-5-15(4-2)20(18,19)11-6-8(12(16)17)9(13)7-10(11)14/h1,6-7H,4-5H2,2H3,(H,16,17) |
| InChIKey | KRKVFWAYHHVIOK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|