C15H23ClN2O4S — CID 50739456
4-chloro-2-(diethylamino)-5-(diethylsulfamoyl)benzoic acid (PubChem CID 50739456) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is 4-chloro-2-(diethylamino)-5-(diethylsulfamoyl)benzoic acid.
| Compound Name | 4-chloro-2-(diethylamino)-5-(diethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 50739456 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-chloro-2-(diethylamino)-5-(diethylsulfamoyl)benzoic acid |
| SMILES | CCN(CC)c1cc(Cl)c(S(=O)(=O)N(CC)CC)cc1C(=O)O |
| InChI | InChI=1S/C15H23ClN2O4S/c1-5-17(6-2)13-10-12(16)14(9-11(13)15(19)20)23(21,22)18(7-3)8-4/h9-10H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | QUXVZDVUQYGMDZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |