C16H24Cl2N2O3S — CID 4776215
2,4-dichloro-5-(diethylsulfamoyl)-N-(2-methylbutan-2-yl)benzamide (PubChem CID 4776215) has the molecular formula C16H24Cl2N2O3S and a molecular weight of 395.35 g/mol. Its IUPAC name is 2,4-dichloro-5-(diethylsulfamoyl)-N-(2-methylbutan-2-yl)benzamide.
| Compound Name | 2,4-dichloro-5-(diethylsulfamoyl)-N-(2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 4776215 |
| Molecular Formula | C16H24Cl2N2O3S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2,4-dichloro-5-(diethylsulfamoyl)-N-(2-methylbutan-2-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NC(C)(C)CC)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2O3S/c1-6-16(4,5)19-15(21)11-9-14(13(18)10-12(11)17)24(22,23)20(7-2)8-3/h9-10H,6-8H2,1-5H3,(H,19,21) |
| InChIKey | NSSUAIKIQQEKOM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |