C19H28Cl2N2O3S — CID 29092836
2,4-dichloro-5-(diethylsulfamoyl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]benzamide (PubChem CID 29092836) has the molecular formula C19H28Cl2N2O3S and a molecular weight of 435.42 g/mol. Its IUPAC name is 2,4-dichloro-5-(diethylsulfamoyl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]benzamide.
| Compound Name | 2,4-dichloro-5-(diethylsulfamoyl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 29092836 |
| Molecular Formula | C19H28Cl2N2O3S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2,4-dichloro-5-(diethylsulfamoyl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N[C@H]2CCC[C@@H](C)C2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H28Cl2N2O3S/c1-5-23(6-2)27(25,26)18-10-14(15(20)11-16(18)21)19(24)22-17-9-7-8-12(3)13(17)4/h10-13,17H,5-9H2,1-4H3,(H,22,24)/t12-,13?,17+/m1/s1 |
| InChIKey | BPFVWYVVMSBMIW-KOHRXURCSA-N |
| XLogP | 4.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |