C21H28ClN3O3S — CID 60539116
2-chloro-4-[[3-(dimethylsulfamoyl)phenyl]methylamino]-N-(2-methylbutan-2-yl)benzamide (PubChem CID 60539116) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is 2-chloro-4-[[3-(dimethylsulfamoyl)phenyl]methylamino]-N-(2-methylbutan-2-yl)benzamide.
| Compound Name | 2-chloro-4-[[3-(dimethylsulfamoyl)phenyl]methylamino]-N-(2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 60539116 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-chloro-4-[[3-(dimethylsulfamoyl)phenyl]methylamino]-N-(2-methylbutan-2-yl)benzamide |
| SMILES | CCC(C)(C)NC(=O)c1ccc(NCc2cccc(S(=O)(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C21H28ClN3O3S/c1-6-21(2,3)24-20(26)18-11-10-16(13-19(18)22)23-14-15-8-7-9-17(12-15)29(27,28)25(4)5/h7-13,23H,6,14H2,1-5H3,(H,24,26) |
| InChIKey | WXXYNBKBOHPEPV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |