C14H20N4O — CID 78971785
N-(1H-1,2,4-triazol-5-ylmethyl)adamantane-2-carboxamide (PubChem CID 78971785) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)adamantane-2-carboxamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)adamantane-2-carboxamide |
|---|---|
| PubChem CID | 78971785 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)adamantane-2-carboxamide |
| SMILES | O=C(NCc1ncn[nH]1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H20N4O/c19-14(15-6-12-16-7-17-18-12)13-10-2-8-1-9(4-10)5-11(13)3-8/h7-11,13H,1-6H2,(H,15,19)(H,16,17,18) |
| InChIKey | WZMGJXKGAJIOEO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |