About 3,7-dihydropurin-6-one
3,7-dihydropurin-6-one (PubChem CID 790) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 3,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 3,7-dihydropurin-6-one |
| PubChem CID | 790 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 3,7-dihydropurin-6-one |
| SMILES | O=c1nc[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | FDGQSTZJBFJUBT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydropurin-6-one?
The IUPAC name of 3,7-dihydropurin-6-one (CID 790) is 3,7-dihydropurin-6-one.
What is the SMILES notation for 3,7-dihydropurin-6-one?
The canonical SMILES for 3,7-dihydropurin-6-one is O=c1nc[nH]c2nc[nH]c12.
What is the InChIKey of 3,7-dihydropurin-6-one?
The InChIKey is FDGQSTZJBFJUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10).
What are the key properties of 3,7-dihydropurin-6-one?
3,7-dihydropurin-6-one has a molecular weight of 136.11 g/mol, XLogP of -0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydropurin-6-one is sourced from PubChem (CID 790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).