C16H32N2 — CID 79067252
3-N,3-N,4-N,3-tetraethyloct-7-yne-3,4-diamine (PubChem CID 79067252) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 3-N,3-N,4-N,3-tetraethyloct-7-yne-3,4-diamine.
| Compound Name | 3-N,3-N,4-N,3-tetraethyloct-7-yne-3,4-diamine |
|---|---|
| PubChem CID | 79067252 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 3-N,3-N,4-N,3-tetraethyloct-7-yne-3,4-diamine |
| SMILES | C#CCCC(NCC)C(CC)(CC)N(CC)CC |
| InChI | InChI=1S/C16H32N2/c1-7-13-14-15(17-10-4)16(8-2,9-3)18(11-5)12-6/h1,15,17H,8-14H2,2-6H3 |
| InChIKey | SDVCVVLSMXIWBV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|