C18H40N2 — CID 79068123
3-N,3-N,4-N,3-tetraethyl-6-methylnonane-3,4-diamine (PubChem CID 79068123) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is 3-N,3-N,4-N,3-tetraethyl-6-methylnonane-3,4-diamine.
| Compound Name | 3-N,3-N,4-N,3-tetraethyl-6-methylnonane-3,4-diamine |
|---|---|
| PubChem CID | 79068123 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | 3-N,3-N,4-N,3-tetraethyl-6-methylnonane-3,4-diamine |
| SMILES | CCCC(C)CC(NCC)C(CC)(CC)N(CC)CC |
| InChI | InChI=1S/C18H40N2/c1-8-14-16(7)15-17(19-11-4)18(9-2,10-3)20(12-5)13-6/h16-17,19H,8-15H2,1-7H3 |
| InChIKey | PICMTYPGKATEFU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |