C18H35NO — CID 79068131
3,6-diethyl-3-pyrrolidin-1-yldecan-4-one (PubChem CID 79068131) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 3,6-diethyl-3-pyrrolidin-1-yldecan-4-one.
| Compound Name | 3,6-diethyl-3-pyrrolidin-1-yldecan-4-one |
|---|---|
| PubChem CID | 79068131 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 3,6-diethyl-3-pyrrolidin-1-yldecan-4-one |
| SMILES | CCCCC(CC)CC(=O)C(CC)(CC)N1CCCC1 |
| InChI | InChI=1S/C18H35NO/c1-5-9-12-16(6-2)15-17(20)18(7-3,8-4)19-13-10-11-14-19/h16H,5-15H2,1-4H3 |
| InChIKey | QEUKOACNRBWOCI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |