C15H28N2S — CID 79068897
4-N,4-N-diethyl-4-methyl-1-thiophen-2-ylhexane-3,4-diamine (PubChem CID 79068897) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is 4-N,4-N-diethyl-4-methyl-1-thiophen-2-ylhexane-3,4-diamine.
| Compound Name | 4-N,4-N-diethyl-4-methyl-1-thiophen-2-ylhexane-3,4-diamine |
|---|---|
| PubChem CID | 79068897 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 4-N,4-N-diethyl-4-methyl-1-thiophen-2-ylhexane-3,4-diamine |
| SMILES | CCN(CC)C(C)(CC)C(N)CCc1cccs1 |
| InChI | InChI=1S/C15H28N2S/c1-5-15(4,17(6-2)7-3)14(16)11-10-13-9-8-12-18-13/h8-9,12,14H,5-7,10-11,16H2,1-4H3 |
| InChIKey | MIVOHZZUVXDOMB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |