C15H20N2 — CID 79079008
N-cyclohex-3-en-1-yl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79079008) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-cyclohex-3-en-1-yl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79079008 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-cyclohex-3-en-1-yl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C1=CCC(NC2CCCc3cccnc32)CC1 |
| InChI | InChI=1S/C15H20N2/c1-2-8-13(9-3-1)17-14-10-4-6-12-7-5-11-16-15(12)14/h1-2,5,7,11,13-14,17H,3-4,6,8-10H2 |
| InChIKey | GYDVIROKRNUCKT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|