C10H13N3S — CID 79089800
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrrol-1-amine (PubChem CID 79089800) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrrol-1-amine.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrrol-1-amine |
|---|---|
| PubChem CID | 79089800 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrrol-1-amine |
| SMILES | Cc1nc(C(C)Nn2cccc2)cs1 |
| InChI | InChI=1S/C10H13N3S/c1-8(10-7-14-9(2)11-10)12-13-5-3-4-6-13/h3-8,12H,1-2H3 |
| InChIKey | NLEZJMMVFILUBF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |