C14H17FN2O — CID 79091005
2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]-5-fluorophenol (PubChem CID 79091005) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]-5-fluorophenol.
| Compound Name | 2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 79091005 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]-5-fluorophenol |
| SMILES | Cc1ccc(C)n1NC(C)c1ccc(F)cc1O |
| InChI | InChI=1S/C14H17FN2O/c1-9-4-5-10(2)17(9)16-11(3)13-7-6-12(15)8-14(13)18/h4-8,11,16,18H,1-3H3 |
| InChIKey | PHBIMAHHECXVHB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|