C10H15N3OS — CID 79100767
N-pyrrol-1-yl-2-thiomorpholin-3-ylacetamide (PubChem CID 79100767) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is N-pyrrol-1-yl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-pyrrol-1-yl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 79100767 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-pyrrol-1-yl-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nn1cccc1 |
| InChI | InChI=1S/C10H15N3OS/c14-10(12-13-4-1-2-5-13)7-9-8-15-6-3-11-9/h1-2,4-5,9,11H,3,6-8H2,(H,12,14) |
| InChIKey | MZOWPLAILMMAID-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |