C12H16N2O4S2 — CID 79139872
4-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]sulfanylthiophene-2-carboxylic acid (PubChem CID 79139872) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]sulfanylthiophene-2-carboxylic acid.
| Compound Name | 4-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]sulfanylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79139872 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]sulfanylthiophene-2-carboxylic acid |
| SMILES | CC(C)CNC(=O)NC(=O)CSc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-7(2)4-13-12(18)14-10(15)6-19-8-3-9(11(16)17)20-5-8/h3,5,7H,4,6H2,1-2H3,(H,16,17)(H2,13,14,15,18) |
| InChIKey | BANACSZDFXJJHC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |