C14H26N4O2 — CID 79152834
N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]azepane-1-carboxamide (PubChem CID 79152834) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]azepane-1-carboxamide.
| Compound Name | N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 79152834 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]azepane-1-carboxamide |
| SMILES | NC(=NO)C1(NC(=O)N2CCCCCC2)CCCCC1 |
| InChI | InChI=1S/C14H26N4O2/c15-12(17-20)14(8-4-3-5-9-14)16-13(19)18-10-6-1-2-7-11-18/h20H,1-11H2,(H2,15,17)(H,16,19) |
| InChIKey | DADQLTSPTOMBIF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|