C7H16N2O3 — CID 79160078
3-(2,3-dihydroxypropyl)-1-ethyl-1-methylurea (PubChem CID 79160078) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(2,3-dihydroxypropyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79160078 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)NCC(O)CO |
| InChI | InChI=1S/C7H16N2O3/c1-3-9(2)7(12)8-4-6(11)5-10/h6,10-11H,3-5H2,1-2H3,(H,8,12) |
| InChIKey | ADVYKPMXZQHUPE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |