C19H17Cl2N3O3 — CID 7916821
(2S)-N-(3-chlorophenyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide (PubChem CID 7916821) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is (2S)-N-(3-chlorophenyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide.
| Compound Name | (2S)-N-(3-chlorophenyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 7916821 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (2S)-N-(3-chlorophenyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(Cl)c1)N1C(=O)N[C@@](C)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-11(16(25)22-13-7-5-6-12(20)10-13)24-17(26)19(2,23-18(24)27)14-8-3-4-9-15(14)21/h3-11H,1-2H3,(H,22,25)(H,23,27)/t11-,19-/m0/s1 |
| InChIKey | PEROEMIAYHLZFE-WLRWDXFRSA-N |
| XLogP | 3.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|