C14H20IN3 — CID 79175056
5-iodo-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)aniline (PubChem CID 79175056) has the molecular formula C14H20IN3 and a molecular weight of 357.24 g/mol. Its IUPAC name is 5-iodo-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)aniline.
| Compound Name | 5-iodo-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)aniline |
|---|---|
| PubChem CID | 79175056 |
| Molecular Formula | C14H20IN3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 5-iodo-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)aniline |
| SMILES | CN1C2CCC1CN(c1ccc(I)cc1N)CC2 |
| InChI | InChI=1S/C14H20IN3/c1-17-11-3-4-12(17)9-18(7-6-11)14-5-2-10(15)8-13(14)16/h2,5,8,11-12H,3-4,6-7,9,16H2,1H3 |
| InChIKey | ILELZELFIVURJV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|