C14H15N3O2 — CID 7918776
(5aR)-7-benzyl-3,4,5a,6-tetrahydro-2H-pyrrolo[3,4-e][1,4]diazepine-5,8-dione (PubChem CID 7918776) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is (5aR)-7-benzyl-3,4,5a,6-tetrahydro-2H-pyrrolo[3,4-e][1,4]diazepine-5,8-dione.
| Compound Name | (5aR)-7-benzyl-3,4,5a,6-tetrahydro-2H-pyrrolo[3,4-e][1,4]diazepine-5,8-dione |
|---|---|
| PubChem CID | 7918776 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (5aR)-7-benzyl-3,4,5a,6-tetrahydro-2H-pyrrolo[3,4-e][1,4]diazepine-5,8-dione |
| SMILES | O=C1NCCN=C2C(=O)N(Cc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C14H15N3O2/c18-13-11-9-17(8-10-4-2-1-3-5-10)14(19)12(11)15-6-7-16-13/h1-5,11H,6-9H2,(H,16,18)/t11-/m1/s1 |
| InChIKey | LUDALVPGKBGRQV-LLVKDONJSA-N |
| XLogP | 0.22 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |