C12H16FNO3S2 — CID 79187805
[3-fluoro-4-(3-methylthiomorpholin-4-yl)sulfonylphenyl]methanol (PubChem CID 79187805) has the molecular formula C12H16FNO3S2 and a molecular weight of 305.40 g/mol. Its IUPAC name is [3-fluoro-4-(3-methylthiomorpholin-4-yl)sulfonylphenyl]methanol.
| Compound Name | [3-fluoro-4-(3-methylthiomorpholin-4-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 79187805 |
| Molecular Formula | C12H16FNO3S2 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [3-fluoro-4-(3-methylthiomorpholin-4-yl)sulfonylphenyl]methanol |
| SMILES | CC1CSCCN1S(=O)(=O)c1ccc(CO)cc1F |
| InChI | InChI=1S/C12H16FNO3S2/c1-9-8-18-5-4-14(9)19(16,17)12-3-2-10(7-15)6-11(12)13/h2-3,6,9,15H,4-5,7-8H2,1H3 |
| InChIKey | HWWTXAMFWNGBES-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |