C14H15N3O3S — CID 79192218
4-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79192218) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79192218 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | Cc1nn(C)c2sc(C(=O)NC3C=CC(C(=O)O)C3)cc12 |
| InChI | InChI=1S/C14H15N3O3S/c1-7-10-6-11(21-13(10)17(2)16-7)12(18)15-9-4-3-8(5-9)14(19)20/h3-4,6,8-9H,5H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | AVWWDHRYBMTHHO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|