C19H17FO2 — CID 7919332
8-[(2-fluorophenyl)methoxy]-1,2,3,4-tetrahydrodibenzofuran (PubChem CID 7919332) has the molecular formula C19H17FO2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 8-[(2-fluorophenyl)methoxy]-1,2,3,4-tetrahydrodibenzofuran.
| Compound Name | 8-[(2-fluorophenyl)methoxy]-1,2,3,4-tetrahydrodibenzofuran |
|---|---|
| PubChem CID | 7919332 |
| Molecular Formula | C19H17FO2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 8-[(2-fluorophenyl)methoxy]-1,2,3,4-tetrahydrodibenzofuran |
| SMILES | Fc1ccccc1COc1ccc2oc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C19H17FO2/c20-17-7-3-1-5-13(17)12-21-14-9-10-19-16(11-14)15-6-2-4-8-18(15)22-19/h1,3,5,7,9-11H,2,4,6,8,12H2 |
| InChIKey | MCYBRHVLCPFAPX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |