C10H17F3N2 — CID 79208146
4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]cyclopent-2-en-1-amine (PubChem CID 79208146) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]cyclopent-2-en-1-amine.
| Compound Name | 4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79208146 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]cyclopent-2-en-1-amine |
| SMILES | CN(CCC(F)(F)F)CC1C=CC(N)C1 |
| InChI | InChI=1S/C10H17F3N2/c1-15(5-4-10(11,12)13)7-8-2-3-9(14)6-8/h2-3,8-9H,4-7,14H2,1H3 |
| InChIKey | BWNPJRCQEZQTGA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|