C11H23FN2 — CID 89176341
(Z)-4-(2-fluoropropyl)-1-N,1-N-dimethylhex-2-ene-1,5-diamine (PubChem CID 89176341) has the molecular formula C11H23FN2 and a molecular weight of 202.32 g/mol. Its IUPAC name is (Z)-4-(2-fluoropropyl)-1-N,1-N-dimethylhex-2-ene-1,5-diamine.
| Compound Name | (Z)-4-(2-fluoropropyl)-1-N,1-N-dimethylhex-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 89176341 |
| Molecular Formula | C11H23FN2 |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | (Z)-4-(2-fluoropropyl)-1-N,1-N-dimethylhex-2-ene-1,5-diamine |
| SMILES | CC(F)CC(/C=C\CN(C)C)C(C)N |
| InChI | InChI=1S/C11H23FN2/c1-9(12)8-11(10(2)13)6-5-7-14(3)4/h5-6,9-11H,7-8,13H2,1-4H3/b6-5- |
| InChIKey | BEYNHTHTQXRAQH-WAYWQWQTSA-N |
| XLogP | 1.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|