C12H19F3N2 — CID 79208147
4-[[3-(trifluoromethyl)piperidin-1-yl]methyl]cyclopent-2-en-1-amine (PubChem CID 79208147) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[[3-(trifluoromethyl)piperidin-1-yl]methyl]cyclopent-2-en-1-amine.
| Compound Name | 4-[[3-(trifluoromethyl)piperidin-1-yl]methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79208147 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-[[3-(trifluoromethyl)piperidin-1-yl]methyl]cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(CN2CCCC(C(F)(F)F)C2)C1 |
| InChI | InChI=1S/C12H19F3N2/c13-12(14,15)10-2-1-5-17(8-10)7-9-3-4-11(16)6-9/h3-4,9-11H,1-2,5-8,16H2 |
| InChIKey | ZXBHIPWOKYTPNT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|