C13H15N3O4 — CID 79216088
4-[(6-methoxy-3-pyridinyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79216088) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[(6-methoxy-3-pyridinyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(6-methoxy-3-pyridinyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79216088 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[(6-methoxy-3-pyridinyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | COc1ccc(NC(=O)NC2C=CC(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C13H15N3O4/c1-20-11-5-4-10(7-14-11)16-13(19)15-9-3-2-8(6-9)12(17)18/h2-5,7-9H,6H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | LAWQBRYYFCGZCK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|