C16H16N2O2S — CID 79227259
1-(2,3-dihydro-1-benzothiophen-2-yl)-N-[(3-nitrophenyl)methyl]methanamine (PubChem CID 79227259) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-[(3-nitrophenyl)methyl]methanamine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-[(3-nitrophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 79227259 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-[(3-nitrophenyl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1cccc(CNCC2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C16H16N2O2S/c19-18(20)14-6-3-4-12(8-14)10-17-11-15-9-13-5-1-2-7-16(13)21-15/h1-8,15,17H,9-11H2 |
| InChIKey | KZJPTPHNNCAJIZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|