About 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline
4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 79227718) has the molecular formula C17H18N2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 79227718 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | c1ccc2c(c1)CC(CN1CCNc3ccccc31)S2 |
| InChI | InChI=1S/C17H18N2S/c1-4-8-17-13(5-1)11-14(20-17)12-19-10-9-18-15-6-2-3-7-16(15)19/h1-8,14,18H,9-12H2 |
| InChIKey | QHXMIZNPCZSPAN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline (CID 79227718) is 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline is c1ccc2c(c1)CC(CN1CCNc3ccccc31)S2.
What is the InChIKey of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline?
The InChIKey is QHXMIZNPCZSPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2S/c1-4-8-17-13(5-1)11-14(20-17)12-19-10-9-18-15-6-2-3-7-16(15)19/h1-8,14,18H,9-12H2.
What are the key properties of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline?
4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline has a molecular weight of 282.41 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 79227718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).