C11H11ClN8O — CID 79234521
4-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 79234521) has the molecular formula C11H11ClN8O and a molecular weight of 306.72 g/mol. Its IUPAC name is 4-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79234521 |
| Molecular Formula | C11H11ClN8O |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1noc(C)c1CNc1nc(Cl)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H11ClN8O/c1-6-8(7(2)21-19-6)3-14-10-16-9(12)17-11(18-10)20-5-13-4-15-20/h4-5H,3H2,1-2H3,(H,14,16,17,18) |
| InChIKey | JSKFUPGIIIIDFE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |