C14H14N2O3S2 — CID 79263304
2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-prop-2-enylamino]acetic acid (PubChem CID 79263304) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79263304 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-2-7-16(8-13(18)19)12(17)9-20-14-15-10-5-3-4-6-11(10)21-14/h2-6H,1,7-9H2,(H,18,19) |
| InChIKey | GPUAOHBPBHPPAY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|