C15H15ClN2OS2 — CID 112779085
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 112779085) has the molecular formula C15H15ClN2OS2 and a molecular weight of 338.89 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 112779085 |
| Molecular Formula | C15H15ClN2OS2 |
| Molecular Weight | 338.89 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C15H15ClN2OS2/c1-3-7-18(8-4-2)14(19)10-20-15-17-12-9-11(16)5-6-13(12)21-15/h3-6,9H,1-2,7-8,10H2 |
| InChIKey | CFOXUDGQIKMVJD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|