C14H18BrN5O — CID 79280049
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-bromoimidazo[4,5-b]pyridin-2-amine (PubChem CID 79280049) has the molecular formula C14H18BrN5O and a molecular weight of 352.24 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-bromoimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-bromoimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79280049 |
| Molecular Formula | C14H18BrN5O |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-bromoimidazo[4,5-b]pyridin-2-amine |
| SMILES | Nc1nc2cc(Br)cnc2n1CC1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H18BrN5O/c15-9-4-12-13(17-5-9)20(14(16)18-12)7-11-6-19-3-1-2-10(19)8-21-11/h4-5,10-11H,1-3,6-8H2,(H2,16,18) |
| InChIKey | VEKCFGBBMQNCET-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |