C11H18N2O5S2 — CID 79285153
2-[(3-methylsulfonylthiomorpholine-4-carbonyl)-prop-2-enylamino]acetic acid (PubChem CID 79285153) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[(3-methylsulfonylthiomorpholine-4-carbonyl)-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(3-methylsulfonylthiomorpholine-4-carbonyl)-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79285153 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[(3-methylsulfonylthiomorpholine-4-carbonyl)-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C11H18N2O5S2/c1-3-4-12(7-10(14)15)11(16)13-5-6-19-8-9(13)20(2,17)18/h3,9H,1,4-8H2,2H3,(H,14,15) |
| InChIKey | HWSILUVUCDKXPO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|