C14H16ClN5 — CID 79297390
5-(chloromethyl)-1,3-dimethyl-6-(2-pyridin-3-ylethyl)imidazo[4,5-d]pyrazole (PubChem CID 79297390) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-6-(2-pyridin-3-ylethyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-6-(2-pyridin-3-ylethyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79297390 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-6-(2-pyridin-3-ylethyl)imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2CCc1cccnc1 |
| InChI | InChI=1S/C14H16ClN5/c1-10-13-14(19(2)18-10)20(12(8-15)17-13)7-5-11-4-3-6-16-9-11/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | KKYCQWIHZLEIPY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|