C13H16BrN3O2S — CID 79306983
methyl 2-(6-bromo-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)-4-methylpentanoate (PubChem CID 79306983) has the molecular formula C13H16BrN3O2S and a molecular weight of 358.26 g/mol. Its IUPAC name is methyl 2-(6-bromo-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)-4-methylpentanoate.
| Compound Name | methyl 2-(6-bromo-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 79306983 |
| Molecular Formula | C13H16BrN3O2S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | methyl 2-(6-bromo-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)n1c(=S)[nH]c2cc(Br)cnc21 |
| InChI | InChI=1S/C13H16BrN3O2S/c1-7(2)4-10(12(18)19-3)17-11-9(16-13(17)20)5-8(14)6-15-11/h5-7,10H,4H2,1-3H3,(H,16,20) |
| InChIKey | GBTNKMMMJHCOOK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|