C22H24N6O — CID 7933017
N-[(4-methylcyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide (PubChem CID 7933017) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is N-[(4-methylcyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide.
| Compound Name | N-[(4-methylcyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 7933017 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[(4-methylcyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide |
| SMILES | CC1CCC(=NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H24N6O/c1-16-7-13-20(14-8-16)23-25-22(29)19-11-9-17(10-12-19)15-28-26-21(24-27-28)18-5-3-2-4-6-18/h2-6,9-12,16H,7-8,13-15H2,1H3,(H,25,29)/b23-20- |
| InChIKey | PXVZGRFKKPLWSX-ATJXCDBQSA-N |
| XLogP | 3.68 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|