C21H20N6O2 — CID 3914961
N-[(3-oxocyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide (PubChem CID 3914961) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[(3-oxocyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide.
| Compound Name | N-[(3-oxocyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3914961 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[(3-oxocyclohexylidene)amino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide |
| SMILES | O=C1CCCC(=NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)C1 |
| InChI | InChI=1S/C21H20N6O2/c28-19-8-4-7-18(13-19)22-24-21(29)17-11-9-15(10-12-17)14-27-25-20(23-26-27)16-5-2-1-3-6-16/h1-3,5-6,9-12H,4,7-8,13-14H2,(H,24,29) |
| InChIKey | BFARDUOHLLOLJW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|