C13H15ClN2 — CID 79335392
2-[2-(chloromethyl)-3-methylbut-1-enyl]imidazo[1,2-a]pyridine (PubChem CID 79335392) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-methylbut-1-enyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[2-(chloromethyl)-3-methylbut-1-enyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 79335392 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-[2-(chloromethyl)-3-methylbut-1-enyl]imidazo[1,2-a]pyridine |
| SMILES | CC(C)C(=Cc1cn2ccccc2n1)CCl |
| InChI | InChI=1S/C13H15ClN2/c1-10(2)11(8-14)7-12-9-16-6-4-3-5-13(16)15-12/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | YUXUXCMMEXTWFQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|