C15H27NO — CID 79338655
(2E)-N-tert-butyl-2-(3,4-dihydro-2H-pyran-2-ylmethylidene)-3-methylbutan-1-amine (PubChem CID 79338655) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2E)-N-tert-butyl-2-(3,4-dihydro-2H-pyran-2-ylmethylidene)-3-methylbutan-1-amine.
| Compound Name | (2E)-N-tert-butyl-2-(3,4-dihydro-2H-pyran-2-ylmethylidene)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 79338655 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2E)-N-tert-butyl-2-(3,4-dihydro-2H-pyran-2-ylmethylidene)-3-methylbutan-1-amine |
| SMILES | CC(C)/C(=C\C1CCC=CO1)CNC(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-12(2)13(11-16-15(3,4)5)10-14-8-6-7-9-17-14/h7,9-10,12,14,16H,6,8,11H2,1-5H3/b13-10- |
| InChIKey | AZQFIBRSDDUNMU-RAXLEYEMSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|